About sodium;methanolate;methyl 6-fluoro-4-methoxy-1H-indole-2-carboxylate
sodium;methanolate;methyl 6-fluoro-4-methoxy-1H-indole-2-carboxylate (PubChem CID 67227531) has the molecular formula C12H13FNNaO4
and a molecular weight of 277.23 g/mol. Its IUPAC name is sodium;methanolate;methyl 6-fluoro-4-methoxy-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | sodium;methanolate;methyl 6-fluoro-4-methoxy-1H-indole-2-carboxylate |
| PubChem CID | 67227531 |
| Molecular Formula | C12H13FNNaO4 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | sodium;methanolate;methyl 6-fluoro-4-methoxy-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1cc2c(OC)cc(F)cc2[nH]1.C[O-].[Na+] |
| InChI | InChI=1S/C11H10FNO3.CH3O.Na/c1-15-10-4-6(12)3-8-7(10)5-9(13-8)11(14)16-2;1-2;/h3-5,13H,1-2H3;1H3;/q;-1;+1 |
| InChIKey | JGRIHRKMAFXQNX-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 74.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium;methanolate;methyl 6-fluoro-4-methoxy-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;methanolate;methyl 6-fluoro-4-methoxy-1H-indole-2-carboxylate?
The IUPAC name of sodium;methanolate;methyl 6-fluoro-4-methoxy-1H-indole-2-carboxylate (CID 67227531) is sodium;methanolate;methyl 6-fluoro-4-methoxy-1H-indole-2-carboxylate.
What is the SMILES notation for sodium;methanolate;methyl 6-fluoro-4-methoxy-1H-indole-2-carboxylate?
The canonical SMILES for sodium;methanolate;methyl 6-fluoro-4-methoxy-1H-indole-2-carboxylate is COC(=O)c1cc2c(OC)cc(F)cc2[nH]1.C[O-].[Na+].
What is the InChIKey of sodium;methanolate;methyl 6-fluoro-4-methoxy-1H-indole-2-carboxylate?
The InChIKey is JGRIHRKMAFXQNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FNO3.CH3O.Na/c1-15-10-4-6(12)3-8-7(10)5-9(13-8)11(14)16-2;1-2;/h3-5,13H,1-2H3;1H3;/q;-1;+1.
What are the key properties of sodium;methanolate;methyl 6-fluoro-4-methoxy-1H-indole-2-carboxylate?
sodium;methanolate;methyl 6-fluoro-4-methoxy-1H-indole-2-carboxylate has a molecular weight of 277.23 g/mol, XLogP of -1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;methanolate;methyl 6-fluoro-4-methoxy-1H-indole-2-carboxylate is sourced from PubChem (CID 67227531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).