C14H15NO5 — CID 10660138
dimethyl 7-methoxy-4-methyl-1H-indole-2,5-dicarboxylate (PubChem CID 10660138) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is dimethyl 7-methoxy-4-methyl-1H-indole-2,5-dicarboxylate.
| Compound Name | dimethyl 7-methoxy-4-methyl-1H-indole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 10660138 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | dimethyl 7-methoxy-4-methyl-1H-indole-2,5-dicarboxylate |
| SMILES | COC(=O)c1cc2c(C)c(C(=O)OC)cc(OC)c2[nH]1 |
| InChI | InChI=1S/C14H15NO5/c1-7-8-5-10(14(17)20-4)15-12(8)11(18-2)6-9(7)13(16)19-3/h5-6,15H,1-4H3 |
| InChIKey | CBYZPUAFOVDKTH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |