methyl 2,3-difluoro-5-methoxy-4-methylbenzoate

C10H10F2O3 — CID 163198256

IUPACmethyl 2,3-difluoro-5-methoxy-4-methylbenzoate
SMILESCOC(=O)c1cc(OC)c(C)c(F)c1F
InChIInChI=1S/C10H10F2O3/c1-5-7(14-2)4-6(10(13)15-3)9(12)8(5)11/h4H,1-3H3
InChIKeyMIJBULIEWGHNBE-UHFFFAOYSA-N
MW216.18 g/mol
LogP2.07
Rot. Bonds2

About methyl 2,3-difluoro-5-methoxy-4-methylbenzoate

methyl 2,3-difluoro-5-methoxy-4-methylbenzoate (PubChem CID 163198256) has the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. Its IUPAC name is methyl 2,3-difluoro-5-methoxy-4-methylbenzoate.

Molecular Properties

Compound Namemethyl 2,3-difluoro-5-methoxy-4-methylbenzoate
PubChem CID163198256
Molecular FormulaC10H10F2O3
Molecular Weight216.18 g/mol
Exact Mass216.06
IUPAC Namemethyl 2,3-difluoro-5-methoxy-4-methylbenzoate
SMILESCOC(=O)c1cc(OC)c(C)c(F)c1F
InChIInChI=1S/C10H10F2O3/c1-5-7(14-2)4-6(10(13)15-3)9(12)8(5)11/h4H,1-3H3
InChIKeyMIJBULIEWGHNBE-UHFFFAOYSA-N
XLogP2.07
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.18
LogP ≤ 52.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2,3-difluoro-5-methoxy-4-methylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,3-difluoro-5-methoxy-4-methylbenzoate?
The IUPAC name of methyl 2,3-difluoro-5-methoxy-4-methylbenzoate (CID 163198256) is methyl 2,3-difluoro-5-methoxy-4-methylbenzoate.
What is the SMILES notation for methyl 2,3-difluoro-5-methoxy-4-methylbenzoate?
The canonical SMILES for methyl 2,3-difluoro-5-methoxy-4-methylbenzoate is COC(=O)c1cc(OC)c(C)c(F)c1F.
What is the InChIKey of methyl 2,3-difluoro-5-methoxy-4-methylbenzoate?
The InChIKey is MIJBULIEWGHNBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2O3/c1-5-7(14-2)4-6(10(13)15-3)9(12)8(5)11/h4H,1-3H3.
What are the key properties of methyl 2,3-difluoro-5-methoxy-4-methylbenzoate?
methyl 2,3-difluoro-5-methoxy-4-methylbenzoate has a molecular weight of 216.18 g/mol, XLogP of 2.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,3-difluoro-5-methoxy-4-methylbenzoate is sourced from PubChem (CID 163198256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).