4,5-dimethoxy-2-methoxycarbonylbenzoic acid

C11H12O6 — CID 23423205

IUPAC4,5-dimethoxy-2-methoxycarbonylbenzoic acid
SMILESCOC(=O)c1cc(OC)c(OC)cc1C(=O)O
InChIInChI=1S/C11H12O6/c1-15-8-4-6(10(12)13)7(11(14)17-3)5-9(8)16-2/h4-5H,1-3H3,(H,12,13)
InChIKeyWJRYOIVXTOLVAE-UHFFFAOYSA-N
MW240.21 g/mol
LogP1.19
Rot. Bonds4

About 4,5-dimethoxy-2-methoxycarbonylbenzoic acid

4,5-dimethoxy-2-methoxycarbonylbenzoic acid (PubChem CID 23423205) has the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. Its IUPAC name is 4,5-dimethoxy-2-methoxycarbonylbenzoic acid.

Molecular Properties

Compound Name4,5-dimethoxy-2-methoxycarbonylbenzoic acid
PubChem CID23423205
Molecular FormulaC11H12O6
Molecular Weight240.21 g/mol
Exact Mass240.06
IUPAC Name4,5-dimethoxy-2-methoxycarbonylbenzoic acid
SMILESCOC(=O)c1cc(OC)c(OC)cc1C(=O)O
InChIInChI=1S/C11H12O6/c1-15-8-4-6(10(12)13)7(11(14)17-3)5-9(8)16-2/h4-5H,1-3H3,(H,12,13)
InChIKeyWJRYOIVXTOLVAE-UHFFFAOYSA-N
XLogP1.19
TPSA82.06 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.21
LogP ≤ 51.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4,5-dimethoxy-2-methoxycarbonylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5-dimethoxy-2-methoxycarbonylbenzoic acid?
The IUPAC name of 4,5-dimethoxy-2-methoxycarbonylbenzoic acid (CID 23423205) is 4,5-dimethoxy-2-methoxycarbonylbenzoic acid.
What is the SMILES notation for 4,5-dimethoxy-2-methoxycarbonylbenzoic acid?
The canonical SMILES for 4,5-dimethoxy-2-methoxycarbonylbenzoic acid is COC(=O)c1cc(OC)c(OC)cc1C(=O)O.
What is the InChIKey of 4,5-dimethoxy-2-methoxycarbonylbenzoic acid?
The InChIKey is WJRYOIVXTOLVAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O6/c1-15-8-4-6(10(12)13)7(11(14)17-3)5-9(8)16-2/h4-5H,1-3H3,(H,12,13).
What are the key properties of 4,5-dimethoxy-2-methoxycarbonylbenzoic acid?
4,5-dimethoxy-2-methoxycarbonylbenzoic acid has a molecular weight of 240.21 g/mol, XLogP of 1.19, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethoxy-2-methoxycarbonylbenzoic acid is sourced from PubChem (CID 23423205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).