C16H16O6 — CID 10494700
dimethyl 6,7-dimethoxynaphthalene-2,3-dicarboxylate (PubChem CID 10494700) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is dimethyl 6,7-dimethoxynaphthalene-2,3-dicarboxylate.
| Compound Name | dimethyl 6,7-dimethoxynaphthalene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10494700 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | dimethyl 6,7-dimethoxynaphthalene-2,3-dicarboxylate |
| SMILES | COC(=O)c1cc2cc(OC)c(OC)cc2cc1C(=O)OC |
| InChI | InChI=1S/C16H16O6/c1-19-13-7-9-5-11(15(17)21-3)12(16(18)22-4)6-10(9)8-14(13)20-2/h5-8H,1-4H3 |
| InChIKey | CLSUUBKHESYDME-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |