C14H18O7 — CID 59569387
dimethyl 4-methoxy-5-(2-methoxyethoxy)benzene-1,2-dicarboxylate (PubChem CID 59569387) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is dimethyl 4-methoxy-5-(2-methoxyethoxy)benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-methoxy-5-(2-methoxyethoxy)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 59569387 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | dimethyl 4-methoxy-5-(2-methoxyethoxy)benzene-1,2-dicarboxylate |
| SMILES | COCCOc1cc(C(=O)OC)c(C(=O)OC)cc1OC |
| InChI | InChI=1S/C14H18O7/c1-17-5-6-21-12-8-10(14(16)20-4)9(13(15)19-3)7-11(12)18-2/h7-8H,5-6H2,1-4H3 |
| InChIKey | QYFPWJBEMLPBJF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|