C15H21NO7 — CID 43037508
methyl 4,5-dimethoxy-2-[[2-(2-methoxyethoxy)acetyl]amino]benzoate (PubChem CID 43037508) has the molecular formula C15H21NO7 and a molecular weight of 327.33 g/mol. Its IUPAC name is methyl 4,5-dimethoxy-2-[[2-(2-methoxyethoxy)acetyl]amino]benzoate.
| Compound Name | methyl 4,5-dimethoxy-2-[[2-(2-methoxyethoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 43037508 |
| Molecular Formula | C15H21NO7 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | methyl 4,5-dimethoxy-2-[[2-(2-methoxyethoxy)acetyl]amino]benzoate |
| SMILES | COCCOCC(=O)Nc1cc(OC)c(OC)cc1C(=O)OC |
| InChI | InChI=1S/C15H21NO7/c1-19-5-6-23-9-14(17)16-11-8-13(21-3)12(20-2)7-10(11)15(18)22-4/h7-8H,5-6,9H2,1-4H3,(H,16,17) |
| InChIKey | NSBQZPMYTWKGKS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|