C19H21NO6 — CID 8801664
methyl 4,5-dimethoxy-2-[[2-(4-methylphenoxy)acetyl]amino]benzoate (PubChem CID 8801664) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is methyl 4,5-dimethoxy-2-[[2-(4-methylphenoxy)acetyl]amino]benzoate.
| Compound Name | methyl 4,5-dimethoxy-2-[[2-(4-methylphenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 8801664 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | methyl 4,5-dimethoxy-2-[[2-(4-methylphenoxy)acetyl]amino]benzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1NC(=O)COc1ccc(C)cc1 |
| InChI | InChI=1S/C19H21NO6/c1-12-5-7-13(8-6-12)26-11-18(21)20-15-10-17(24-3)16(23-2)9-14(15)19(22)25-4/h5-10H,11H2,1-4H3,(H,20,21) |
| InChIKey | INYGIGJQGXDKMQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |