C13H17NO6 — CID 63744788
4-methoxy-3-[[2-(2-methoxyethoxy)acetyl]amino]benzoic acid (PubChem CID 63744788) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is 4-methoxy-3-[[2-(2-methoxyethoxy)acetyl]amino]benzoic acid.
| Compound Name | 4-methoxy-3-[[2-(2-methoxyethoxy)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 63744788 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 4-methoxy-3-[[2-(2-methoxyethoxy)acetyl]amino]benzoic acid |
| SMILES | COCCOCC(=O)Nc1cc(C(=O)O)ccc1OC |
| InChI | InChI=1S/C13H17NO6/c1-18-5-6-20-8-12(15)14-10-7-9(13(16)17)3-4-11(10)19-2/h3-4,7H,5-6,8H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | KTINYTPQLKNSLV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|