C19H21NO7 — CID 119214155
3,4-dimethoxy-5-[[2-(2-phenoxyethoxy)acetyl]amino]benzoic acid (PubChem CID 119214155) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is 3,4-dimethoxy-5-[[2-(2-phenoxyethoxy)acetyl]amino]benzoic acid.
| Compound Name | 3,4-dimethoxy-5-[[2-(2-phenoxyethoxy)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 119214155 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 3,4-dimethoxy-5-[[2-(2-phenoxyethoxy)acetyl]amino]benzoic acid |
| SMILES | COc1cc(C(=O)O)cc(NC(=O)COCCOc2ccccc2)c1OC |
| InChI | InChI=1S/C19H21NO7/c1-24-16-11-13(19(22)23)10-15(18(16)25-2)20-17(21)12-26-8-9-27-14-6-4-3-5-7-14/h3-7,10-11H,8-9,12H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | YBWPYWWGYOVYFD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|