C17H18FNO4 — CID 86998252
N-(4-fluoro-2-methoxyphenyl)-2-(2-phenoxyethoxy)acetamide (PubChem CID 86998252) has the molecular formula C17H18FNO4 and a molecular weight of 319.33 g/mol. Its IUPAC name is N-(4-fluoro-2-methoxyphenyl)-2-(2-phenoxyethoxy)acetamide.
| Compound Name | N-(4-fluoro-2-methoxyphenyl)-2-(2-phenoxyethoxy)acetamide |
|---|---|
| PubChem CID | 86998252 |
| Molecular Formula | C17H18FNO4 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-(4-fluoro-2-methoxyphenyl)-2-(2-phenoxyethoxy)acetamide |
| SMILES | COc1cc(F)ccc1NC(=O)COCCOc1ccccc1 |
| InChI | InChI=1S/C17H18FNO4/c1-21-16-11-13(18)7-8-15(16)19-17(20)12-22-9-10-23-14-5-3-2-4-6-14/h2-8,11H,9-10,12H2,1H3,(H,19,20) |
| InChIKey | IXDBDUQQHBWKOG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|