C11H13FINO3 — CID 103737178
N-(4-fluoro-2-iodophenyl)-2-(2-methoxyethoxy)acetamide (PubChem CID 103737178) has the molecular formula C11H13FINO3 and a molecular weight of 353.13 g/mol. Its IUPAC name is N-(4-fluoro-2-iodophenyl)-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-(4-fluoro-2-iodophenyl)-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 103737178 |
| Molecular Formula | C11H13FINO3 |
| Molecular Weight | 353.13 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | N-(4-fluoro-2-iodophenyl)-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)Nc1ccc(F)cc1I |
| InChI | InChI=1S/C11H13FINO3/c1-16-4-5-17-7-11(15)14-10-3-2-8(12)6-9(10)13/h2-3,6H,4-5,7H2,1H3,(H,14,15) |
| InChIKey | HFGKPJIYEPHSJZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.13 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|