C13H19FN2O4 — CID 104560278
N-(2-amino-5-fluorophenyl)-2-[2-(2-methoxyethoxy)ethoxy]acetamide (PubChem CID 104560278) has the molecular formula C13H19FN2O4 and a molecular weight of 286.30 g/mol. Its IUPAC name is N-(2-amino-5-fluorophenyl)-2-[2-(2-methoxyethoxy)ethoxy]acetamide.
| Compound Name | N-(2-amino-5-fluorophenyl)-2-[2-(2-methoxyethoxy)ethoxy]acetamide |
|---|---|
| PubChem CID | 104560278 |
| Molecular Formula | C13H19FN2O4 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-(2-amino-5-fluorophenyl)-2-[2-(2-methoxyethoxy)ethoxy]acetamide |
| SMILES | COCCOCCOCC(=O)Nc1cc(F)ccc1N |
| InChI | InChI=1S/C13H19FN2O4/c1-18-4-5-19-6-7-20-9-13(17)16-12-8-10(14)2-3-11(12)15/h2-3,8H,4-7,9,15H2,1H3,(H,16,17) |
| InChIKey | QASAFLVUURPYDJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|