C14H22N2O5 — CID 104560142
N-(2-amino-4-methoxyphenyl)-2-[2-(2-methoxyethoxy)ethoxy]acetamide (PubChem CID 104560142) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is N-(2-amino-4-methoxyphenyl)-2-[2-(2-methoxyethoxy)ethoxy]acetamide.
| Compound Name | N-(2-amino-4-methoxyphenyl)-2-[2-(2-methoxyethoxy)ethoxy]acetamide |
|---|---|
| PubChem CID | 104560142 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N-(2-amino-4-methoxyphenyl)-2-[2-(2-methoxyethoxy)ethoxy]acetamide |
| SMILES | COCCOCCOCC(=O)Nc1ccc(OC)cc1N |
| InChI | InChI=1S/C14H22N2O5/c1-18-5-6-20-7-8-21-10-14(17)16-13-4-3-11(19-2)9-12(13)15/h3-4,9H,5-8,10,15H2,1-2H3,(H,16,17) |
| InChIKey | YTBSNRFXEVSTAF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|