C14H21FN2O4 — CID 104560276
N-(2-amino-4-fluorophenyl)-3-[2-(2-methoxyethoxy)ethoxy]propanamide (PubChem CID 104560276) has the molecular formula C14H21FN2O4 and a molecular weight of 300.33 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-3-[2-(2-methoxyethoxy)ethoxy]propanamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-3-[2-(2-methoxyethoxy)ethoxy]propanamide |
|---|---|
| PubChem CID | 104560276 |
| Molecular Formula | C14H21FN2O4 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-3-[2-(2-methoxyethoxy)ethoxy]propanamide |
| SMILES | COCCOCCOCCC(=O)Nc1ccc(F)cc1N |
| InChI | InChI=1S/C14H21FN2O4/c1-19-6-7-21-9-8-20-5-4-14(18)17-13-3-2-11(15)10-12(13)16/h2-3,10H,4-9,16H2,1H3,(H,17,18) |
| InChIKey | YEBFTDZBKUDNNS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|