C10H14N2O3 — CID 107697634
N-(2-amino-4-hydroxyphenyl)-3-methoxypropanamide (PubChem CID 107697634) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is N-(2-amino-4-hydroxyphenyl)-3-methoxypropanamide.
| Compound Name | N-(2-amino-4-hydroxyphenyl)-3-methoxypropanamide |
|---|---|
| PubChem CID | 107697634 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | N-(2-amino-4-hydroxyphenyl)-3-methoxypropanamide |
| SMILES | COCCC(=O)Nc1ccc(O)cc1N |
| InChI | InChI=1S/C10H14N2O3/c1-15-5-4-10(14)12-9-3-2-7(13)6-8(9)11/h2-3,6,13H,4-5,11H2,1H3,(H,12,14) |
| InChIKey | PQAAZMJHBOTSDA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|