C11H14F2N2O3 — CID 107697254
N-(2-amino-4-hydroxyphenyl)-3-(2,2-difluoroethoxy)propanamide (PubChem CID 107697254) has the molecular formula C11H14F2N2O3 and a molecular weight of 260.24 g/mol. Its IUPAC name is N-(2-amino-4-hydroxyphenyl)-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-(2-amino-4-hydroxyphenyl)-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 107697254 |
| Molecular Formula | C11H14F2N2O3 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | N-(2-amino-4-hydroxyphenyl)-3-(2,2-difluoroethoxy)propanamide |
| SMILES | Nc1cc(O)ccc1NC(=O)CCOCC(F)F |
| InChI | InChI=1S/C11H14F2N2O3/c12-10(13)6-18-4-3-11(17)15-9-2-1-7(16)5-8(9)14/h1-2,5,10,16H,3-4,6,14H2,(H,15,17) |
| InChIKey | NLAGDYIGWUIYKO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|