C11H13F3N2O4S — CID 103208721
3-(2,2-difluoroethoxy)-N-(3-fluoro-4-sulfamoylphenyl)propanamide (PubChem CID 103208721) has the molecular formula C11H13F3N2O4S and a molecular weight of 326.30 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-(3-fluoro-4-sulfamoylphenyl)propanamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-(3-fluoro-4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 103208721 |
| Molecular Formula | C11H13F3N2O4S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-(3-fluoro-4-sulfamoylphenyl)propanamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CCOCC(F)F)cc1F |
| InChI | InChI=1S/C11H13F3N2O4S/c12-8-5-7(1-2-9(8)21(15,18)19)16-11(17)3-4-20-6-10(13)14/h1-2,5,10H,3-4,6H2,(H,16,17)(H2,15,18,19) |
| InChIKey | UJCKNCXCUTVHBS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|