C12H12F2N2O2 — CID 82005179
N-(4-cyanophenyl)-3-(2,2-difluoroethoxy)propanamide (PubChem CID 82005179) has the molecular formula C12H12F2N2O2 and a molecular weight of 254.24 g/mol. Its IUPAC name is N-(4-cyanophenyl)-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-(4-cyanophenyl)-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 82005179 |
| Molecular Formula | C12H12F2N2O2 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | N-(4-cyanophenyl)-3-(2,2-difluoroethoxy)propanamide |
| SMILES | N#Cc1ccc(NC(=O)CCOCC(F)F)cc1 |
| InChI | InChI=1S/C12H12F2N2O2/c13-11(14)8-18-6-5-12(17)16-10-3-1-9(7-15)2-4-10/h1-4,11H,5-6,8H2,(H,16,17) |
| InChIKey | KAFBEVLWSPBRMY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|