C14H15F2NO4 — CID 103205841
(E)-3-[4-[3-(2,2-difluoroethoxy)propanoylamino]phenyl]prop-2-enoic acid (PubChem CID 103205841) has the molecular formula C14H15F2NO4 and a molecular weight of 299.27 g/mol. Its IUPAC name is (E)-3-[4-[3-(2,2-difluoroethoxy)propanoylamino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-(2,2-difluoroethoxy)propanoylamino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103205841 |
| Molecular Formula | C14H15F2NO4 |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (E)-3-[4-[3-(2,2-difluoroethoxy)propanoylamino]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(NC(=O)CCOCC(F)F)cc1 |
| InChI | InChI=1S/C14H15F2NO4/c15-12(16)9-21-8-7-13(18)17-11-4-1-10(2-5-11)3-6-14(19)20/h1-6,12H,7-9H2,(H,17,18)(H,19,20)/b6-3+ |
| InChIKey | DZVVHNMXQIWTLE-ZZXKWVIFSA-N |
| XLogP | 2.39 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|