C12H12ClF2NO4 — CID 103205870
2-chloro-5-[3-(2,2-difluoroethoxy)propanoylamino]benzoic acid (PubChem CID 103205870) has the molecular formula C12H12ClF2NO4 and a molecular weight of 307.68 g/mol. Its IUPAC name is 2-chloro-5-[3-(2,2-difluoroethoxy)propanoylamino]benzoic acid.
| Compound Name | 2-chloro-5-[3-(2,2-difluoroethoxy)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 103205870 |
| Molecular Formula | C12H12ClF2NO4 |
| Molecular Weight | 307.68 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 2-chloro-5-[3-(2,2-difluoroethoxy)propanoylamino]benzoic acid |
| SMILES | O=C(CCOCC(F)F)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H12ClF2NO4/c13-9-2-1-7(5-8(9)12(18)19)16-11(17)3-4-20-6-10(14)15/h1-2,5,10H,3-4,6H2,(H,16,17)(H,18,19) |
| InChIKey | CRCAGZFNYMLGBX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.68 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|