C12H15F2NO3 — CID 103208634
3-(2,2-difluoroethoxy)-N-(2-hydroxy-4-methylphenyl)propanamide (PubChem CID 103208634) has the molecular formula C12H15F2NO3 and a molecular weight of 259.25 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-(2-hydroxy-4-methylphenyl)propanamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-(2-hydroxy-4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 103208634 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-(2-hydroxy-4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)CCOCC(F)F)c(O)c1 |
| InChI | InChI=1S/C12H15F2NO3/c1-8-2-3-9(10(16)6-8)15-12(17)4-5-18-7-11(13)14/h2-3,6,11,16H,4-5,7H2,1H3,(H,15,17) |
| InChIKey | MRSVEDKJLKJAFL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|