C12H15NO2 — CID 62677203
N-(2-hydroxy-4-methylphenyl)pent-4-enamide (PubChem CID 62677203) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is N-(2-hydroxy-4-methylphenyl)pent-4-enamide.
| Compound Name | N-(2-hydroxy-4-methylphenyl)pent-4-enamide |
|---|---|
| PubChem CID | 62677203 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N-(2-hydroxy-4-methylphenyl)pent-4-enamide |
| SMILES | C=CCCC(=O)Nc1ccc(C)cc1O |
| InChI | InChI=1S/C12H15NO2/c1-3-4-5-12(15)13-10-7-6-9(2)8-11(10)14/h3,6-8,14H,1,4-5H2,2H3,(H,13,15) |
| InChIKey | OPFCLYXJZFTEAG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|