C12H13NO4 — CID 55102905
5-hydroxy-2-(pent-4-enoylamino)benzoic acid (PubChem CID 55102905) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 5-hydroxy-2-(pent-4-enoylamino)benzoic acid.
| Compound Name | 5-hydroxy-2-(pent-4-enoylamino)benzoic acid |
|---|---|
| PubChem CID | 55102905 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 5-hydroxy-2-(pent-4-enoylamino)benzoic acid |
| SMILES | C=CCCC(=O)Nc1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C12H13NO4/c1-2-3-4-11(15)13-10-6-5-8(14)7-9(10)12(16)17/h2,5-7,14H,1,3-4H2,(H,13,15)(H,16,17) |
| InChIKey | JQEGZGAFUPQVFH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|