3,5-dimethyl-2-(pent-4-enoylamino)benzoic acid

C14H17NO3 — CID 63112138

IUPAC3,5-dimethyl-2-(pent-4-enoylamino)benzoic acid
SMILESC=CCCC(=O)Nc1c(C)cc(C)cc1C(=O)O
InChIInChI=1S/C14H17NO3/c1-4-5-6-12(16)15-13-10(3)7-9(2)8-11(13)14(17)18/h4,7-8H,1,5-6H2,2-3H3,(H,15,16)(H,17,18)
InChIKeyJMRWOGWCGMDHBO-UHFFFAOYSA-N
MW247.29 g/mol
LogP2.91
Rot. Bonds5

About 3,5-dimethyl-2-(pent-4-enoylamino)benzoic acid

3,5-dimethyl-2-(pent-4-enoylamino)benzoic acid (PubChem CID 63112138) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 3,5-dimethyl-2-(pent-4-enoylamino)benzoic acid.

Molecular Properties

Compound Name3,5-dimethyl-2-(pent-4-enoylamino)benzoic acid
PubChem CID63112138
Molecular FormulaC14H17NO3
Molecular Weight247.29 g/mol
Exact Mass247.12
IUPAC Name3,5-dimethyl-2-(pent-4-enoylamino)benzoic acid
SMILESC=CCCC(=O)Nc1c(C)cc(C)cc1C(=O)O
InChIInChI=1S/C14H17NO3/c1-4-5-6-12(16)15-13-10(3)7-9(2)8-11(13)14(17)18/h4,7-8H,1,5-6H2,2-3H3,(H,15,16)(H,17,18)
InChIKeyJMRWOGWCGMDHBO-UHFFFAOYSA-N
XLogP2.91
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.29
LogP ≤ 52.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 3,5-dimethyl-2-(pent-4-enoylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dimethyl-2-(pent-4-enoylamino)benzoic acid?
The IUPAC name of 3,5-dimethyl-2-(pent-4-enoylamino)benzoic acid (CID 63112138) is 3,5-dimethyl-2-(pent-4-enoylamino)benzoic acid.
What is the SMILES notation for 3,5-dimethyl-2-(pent-4-enoylamino)benzoic acid?
The canonical SMILES for 3,5-dimethyl-2-(pent-4-enoylamino)benzoic acid is C=CCCC(=O)Nc1c(C)cc(C)cc1C(=O)O.
What is the InChIKey of 3,5-dimethyl-2-(pent-4-enoylamino)benzoic acid?
The InChIKey is JMRWOGWCGMDHBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3/c1-4-5-6-12(16)15-13-10(3)7-9(2)8-11(13)14(17)18/h4,7-8H,1,5-6H2,2-3H3,(H,15,16)(H,17,18).
What are the key properties of 3,5-dimethyl-2-(pent-4-enoylamino)benzoic acid?
3,5-dimethyl-2-(pent-4-enoylamino)benzoic acid has a molecular weight of 247.29 g/mol, XLogP of 2.91, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-2-(pent-4-enoylamino)benzoic acid is sourced from PubChem (CID 63112138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).