C16H20N2O3 — CID 63112570
2-[bis(prop-2-enyl)carbamoylamino]-3,5-dimethylbenzoic acid (PubChem CID 63112570) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[bis(prop-2-enyl)carbamoylamino]-3,5-dimethylbenzoic acid.
| Compound Name | 2-[bis(prop-2-enyl)carbamoylamino]-3,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 63112570 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-[bis(prop-2-enyl)carbamoylamino]-3,5-dimethylbenzoic acid |
| SMILES | C=CCN(CC=C)C(=O)Nc1c(C)cc(C)cc1C(=O)O |
| InChI | InChI=1S/C16H20N2O3/c1-5-7-18(8-6-2)16(21)17-14-12(4)9-11(3)10-13(14)15(19)20/h5-6,9-10H,1-2,7-8H2,3-4H3,(H,17,21)(H,19,20) |
| InChIKey | UDZYKKJFRHLZSO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|