C12H14N2O5 — CID 61405990
2-(3-acetamidopropanoylamino)-5-hydroxybenzoic acid (PubChem CID 61405990) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is 2-(3-acetamidopropanoylamino)-5-hydroxybenzoic acid.
| Compound Name | 2-(3-acetamidopropanoylamino)-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 61405990 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-(3-acetamidopropanoylamino)-5-hydroxybenzoic acid |
| SMILES | CC(=O)NCCC(=O)Nc1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C12H14N2O5/c1-7(15)13-5-4-11(17)14-10-3-2-8(16)6-9(10)12(18)19/h2-3,6,16H,4-5H2,1H3,(H,13,15)(H,14,17)(H,18,19) |
| InChIKey | KNHAEORIRWIVIA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|