C11H14N2O3 — CID 47110153
3-acetamido-N-(2-hydroxyphenyl)propanamide (PubChem CID 47110153) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 3-acetamido-N-(2-hydroxyphenyl)propanamide.
| Compound Name | 3-acetamido-N-(2-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 47110153 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 3-acetamido-N-(2-hydroxyphenyl)propanamide |
| SMILES | CC(=O)NCCC(=O)Nc1ccccc1O |
| InChI | InChI=1S/C11H14N2O3/c1-8(14)12-7-6-11(16)13-9-4-2-3-5-10(9)15/h2-5,15H,6-7H2,1H3,(H,12,14)(H,13,16) |
| InChIKey | LKFFQSIMRFOKMB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|