C13H17N3O3 — CID 110606657
2-(3-acetamidopropanoylamino)-N-methylbenzamide (PubChem CID 110606657) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-(3-acetamidopropanoylamino)-N-methylbenzamide.
| Compound Name | 2-(3-acetamidopropanoylamino)-N-methylbenzamide |
|---|---|
| PubChem CID | 110606657 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-(3-acetamidopropanoylamino)-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1NC(=O)CCNC(C)=O |
| InChI | InChI=1S/C13H17N3O3/c1-9(17)15-8-7-12(18)16-11-6-4-3-5-10(11)13(19)14-2/h3-6H,7-8H2,1-2H3,(H,14,19)(H,15,17)(H,16,18) |
| InChIKey | KGXVFVNPKQEALS-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |