C12H15N3O5 — CID 61406098
2-[(4-amino-4-oxobutyl)carbamoylamino]-5-hydroxybenzoic acid (PubChem CID 61406098) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is 2-[(4-amino-4-oxobutyl)carbamoylamino]-5-hydroxybenzoic acid.
| Compound Name | 2-[(4-amino-4-oxobutyl)carbamoylamino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 61406098 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-[(4-amino-4-oxobutyl)carbamoylamino]-5-hydroxybenzoic acid |
| SMILES | NC(=O)CCCNC(=O)Nc1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C12H15N3O5/c13-10(17)2-1-5-14-12(20)15-9-4-3-7(16)6-8(9)11(18)19/h3-4,6,16H,1-2,5H2,(H2,13,17)(H,18,19)(H2,14,15,20) |
| InChIKey | ZOYILROBLAODDM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|