C20H24Cl2N4O4 — CID 4520797
1-(2-chloro-4-hydroxyphenyl)-3-[6-[(2-chloro-4-hydroxyphenyl)carbamoylamino]hexyl]urea (PubChem CID 4520797) has the molecular formula C20H24Cl2N4O4 and a molecular weight of 455.34 g/mol. Its IUPAC name is 1-(2-chloro-4-hydroxyphenyl)-3-[6-[(2-chloro-4-hydroxyphenyl)carbamoylamino]hexyl]urea.
| Compound Name | 1-(2-chloro-4-hydroxyphenyl)-3-[6-[(2-chloro-4-hydroxyphenyl)carbamoylamino]hexyl]urea |
|---|---|
| PubChem CID | 4520797 |
| Molecular Formula | C20H24Cl2N4O4 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 1-(2-chloro-4-hydroxyphenyl)-3-[6-[(2-chloro-4-hydroxyphenyl)carbamoylamino]hexyl]urea |
| SMILES | O=C(NCCCCCCNC(=O)Nc1ccc(O)cc1Cl)Nc1ccc(O)cc1Cl |
| InChI | InChI=1S/C20H24Cl2N4O4/c21-15-11-13(27)5-7-17(15)25-19(29)23-9-3-1-2-4-10-24-20(30)26-18-8-6-14(28)12-16(18)22/h5-8,11-12,27-28H,1-4,9-10H2,(H2,23,25,29)(H2,24,26,30) |
| InChIKey | VTBSYRZWRQUFPC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|