C13H9Cl3N2O2 — CID 64788337
1-(2-chloro-4-hydroxyphenyl)-3-(3,4-dichlorophenyl)urea (PubChem CID 64788337) has the molecular formula C13H9Cl3N2O2 and a molecular weight of 331.59 g/mol. Its IUPAC name is 1-(2-chloro-4-hydroxyphenyl)-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-(2-chloro-4-hydroxyphenyl)-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 64788337 |
| Molecular Formula | C13H9Cl3N2O2 |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 1-(2-chloro-4-hydroxyphenyl)-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1ccc(O)cc1Cl |
| InChI | InChI=1S/C13H9Cl3N2O2/c14-9-3-1-7(5-10(9)15)17-13(20)18-12-4-2-8(19)6-11(12)16/h1-6,19H,(H2,17,18,20) |
| InChIKey | UPNOKTPWRXTPOP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|