C17H12Cl2N2O2 — CID 54581582
1-(3,4-dichlorophenyl)-3-(7-hydroxynaphthalen-1-yl)urea (PubChem CID 54581582) has the molecular formula C17H12Cl2N2O2 and a molecular weight of 347.20 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(7-hydroxynaphthalen-1-yl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(7-hydroxynaphthalen-1-yl)urea |
|---|---|
| PubChem CID | 54581582 |
| Molecular Formula | C17H12Cl2N2O2 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(7-hydroxynaphthalen-1-yl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1cccc2ccc(O)cc12 |
| InChI | InChI=1S/C17H12Cl2N2O2/c18-14-7-5-11(8-15(14)19)20-17(23)21-16-3-1-2-10-4-6-12(22)9-13(10)16/h1-9,22H,(H2,20,21,23) |
| InChIKey | HYPVVYCUIRGGJB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |