C23H18N2O3 — CID 10133734
1-(7-hydroxynaphthalen-1-yl)-3-(4-phenoxyphenyl)urea (PubChem CID 10133734) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 1-(7-hydroxynaphthalen-1-yl)-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-(7-hydroxynaphthalen-1-yl)-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 10133734 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1-(7-hydroxynaphthalen-1-yl)-3-(4-phenoxyphenyl)urea |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)Nc1cccc2ccc(O)cc12 |
| InChI | InChI=1S/C23H18N2O3/c26-18-12-9-16-5-4-8-22(21(16)15-18)25-23(27)24-17-10-13-20(14-11-17)28-19-6-2-1-3-7-19/h1-15,26H,(H2,24,25,27) |
| InChIKey | BEWBRYIDOSDRIG-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |