C14H11N3O2S — CID 5330590
1-(7-hydroxynaphthalen-1-yl)-3-(1,3-thiazol-2-yl)urea (PubChem CID 5330590) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is 1-(7-hydroxynaphthalen-1-yl)-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-(7-hydroxynaphthalen-1-yl)-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 5330590 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 1-(7-hydroxynaphthalen-1-yl)-3-(1,3-thiazol-2-yl)urea |
| SMILES | O=C(Nc1nccs1)Nc1cccc2ccc(O)cc12 |
| InChI | InChI=1S/C14H11N3O2S/c18-10-5-4-9-2-1-3-12(11(9)8-10)16-13(19)17-14-15-6-7-20-14/h1-8,18H,(H2,15,16,17,19) |
| InChIKey | OGVBOMQMFJXWFR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |