C14H13NO2Y — CID 59524572
N-(7-hydroxynaphthalen-1-yl)-2-methylprop-2-enamide;yttrium (PubChem CID 59524572) has the molecular formula C14H13NO2Y and a molecular weight of 316.17 g/mol. Its IUPAC name is N-(7-hydroxynaphthalen-1-yl)-2-methylprop-2-enamide;yttrium.
| Compound Name | N-(7-hydroxynaphthalen-1-yl)-2-methylprop-2-enamide;yttrium |
|---|---|
| PubChem CID | 59524572 |
| Molecular Formula | C14H13NO2Y |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | N-(7-hydroxynaphthalen-1-yl)-2-methylprop-2-enamide;yttrium |
| SMILES | C=C(C)C(=O)Nc1cccc2ccc(O)cc12.[Y] |
| InChI | InChI=1S/C14H13NO2.Y/c1-9(2)14(17)15-13-5-3-4-10-6-7-11(16)8-12(10)13;/h3-8,16H,1H2,2H3,(H,15,17); |
| InChIKey | RGAAMVJKQPTIHD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|