C16H22N2O3 — CID 91324175
ethane;2-(2-hydroxyethylamino)-N-(7-hydroxynaphthalen-1-yl)acetamide (PubChem CID 91324175) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is ethane;2-(2-hydroxyethylamino)-N-(7-hydroxynaphthalen-1-yl)acetamide.
| Compound Name | ethane;2-(2-hydroxyethylamino)-N-(7-hydroxynaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 91324175 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | ethane;2-(2-hydroxyethylamino)-N-(7-hydroxynaphthalen-1-yl)acetamide |
| SMILES | CC.O=C(CNCCO)Nc1cccc2ccc(O)cc12 |
| InChI | InChI=1S/C14H16N2O3.C2H6/c17-7-6-15-9-14(19)16-13-3-1-2-10-4-5-11(18)8-12(10)13;1-2/h1-5,8,15,17-18H,6-7,9H2,(H,16,19);1-2H3 |
| InChIKey | OUHKSJOVRSCUKH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|