C12H13ClN2O2 — CID 70150550
2-amino-N-(7-hydroxynaphthalen-1-yl)acetamide;hydrochloride (PubChem CID 70150550) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is 2-amino-N-(7-hydroxynaphthalen-1-yl)acetamide;hydrochloride.
| Compound Name | 2-amino-N-(7-hydroxynaphthalen-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 70150550 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-amino-N-(7-hydroxynaphthalen-1-yl)acetamide;hydrochloride |
| SMILES | Cl.NCC(=O)Nc1cccc2ccc(O)cc12 |
| InChI | InChI=1S/C12H12N2O2.ClH/c13-7-12(16)14-11-3-1-2-8-4-5-9(15)6-10(8)11;/h1-6,15H,7,13H2,(H,14,16);1H |
| InChIKey | SIBMRLCEVYRYDU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |