C22H34N2O2S — CID 145260626
N-[2-(2,4-dimethylphenyl)sulfanylphenyl]-2-(2-hydroxyethylamino)acetamide;ethane (PubChem CID 145260626) has the molecular formula C22H34N2O2S and a molecular weight of 390.59 g/mol. Its IUPAC name is N-[2-(2,4-dimethylphenyl)sulfanylphenyl]-2-(2-hydroxyethylamino)acetamide;ethane.
| Compound Name | N-[2-(2,4-dimethylphenyl)sulfanylphenyl]-2-(2-hydroxyethylamino)acetamide;ethane |
|---|---|
| PubChem CID | 145260626 |
| Molecular Formula | C22H34N2O2S |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N-[2-(2,4-dimethylphenyl)sulfanylphenyl]-2-(2-hydroxyethylamino)acetamide;ethane |
| SMILES | CC.CC.Cc1ccc(Sc2ccccc2NC(=O)CNCCO)c(C)c1 |
| InChI | InChI=1S/C18H22N2O2S.2C2H6/c1-13-7-8-16(14(2)11-13)23-17-6-4-3-5-15(17)20-18(22)12-19-9-10-21;2*1-2/h3-8,11,19,21H,9-10,12H2,1-2H3,(H,20,22);2*1-2H3 |
| InChIKey | LAOMOZIAQHDKHP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|