C22H21NOS — CID 28571076
2-(2,5-dimethylphenyl)-N-(2-phenylsulfanylphenyl)acetamide (PubChem CID 28571076) has the molecular formula C22H21NOS and a molecular weight of 347.48 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-N-(2-phenylsulfanylphenyl)acetamide.
| Compound Name | 2-(2,5-dimethylphenyl)-N-(2-phenylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 28571076 |
| Molecular Formula | C22H21NOS |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-N-(2-phenylsulfanylphenyl)acetamide |
| SMILES | Cc1ccc(C)c(CC(=O)Nc2ccccc2Sc2ccccc2)c1 |
| InChI | InChI=1S/C22H21NOS/c1-16-12-13-17(2)18(14-16)15-22(24)23-20-10-6-7-11-21(20)25-19-8-4-3-5-9-19/h3-14H,15H2,1-2H3,(H,23,24) |
| InChIKey | ZQMSYBWHNLPRCZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |