C23H22N2O2S2 — CID 34219891
N-(4-methylphenyl)-2-[2-oxo-2-(2-phenylsulfanylanilino)ethyl]sulfanylacetamide (PubChem CID 34219891) has the molecular formula C23H22N2O2S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[2-oxo-2-(2-phenylsulfanylanilino)ethyl]sulfanylacetamide.
| Compound Name | N-(4-methylphenyl)-2-[2-oxo-2-(2-phenylsulfanylanilino)ethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 34219891 |
| Molecular Formula | C23H22N2O2S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | N-(4-methylphenyl)-2-[2-oxo-2-(2-phenylsulfanylanilino)ethyl]sulfanylacetamide |
| SMILES | Cc1ccc(NC(=O)CSCC(=O)Nc2ccccc2Sc2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N2O2S2/c1-17-11-13-18(14-12-17)24-22(26)15-28-16-23(27)25-20-9-5-6-10-21(20)29-19-7-3-2-4-8-19/h2-14H,15-16H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | KHCZRWSVUMZETB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |