C21H18ClNOS2 — CID 4153660
2-[(4-chlorophenyl)methylsulfanyl]-N-(2-phenylsulfanylphenyl)acetamide (PubChem CID 4153660) has the molecular formula C21H18ClNOS2 and a molecular weight of 399.97 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-N-(2-phenylsulfanylphenyl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-(2-phenylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 4153660 |
| Molecular Formula | C21H18ClNOS2 |
| Molecular Weight | 399.97 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-(2-phenylsulfanylphenyl)acetamide |
| SMILES | O=C(CSCc1ccc(Cl)cc1)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C21H18ClNOS2/c22-17-12-10-16(11-13-17)14-25-15-21(24)23-19-8-4-5-9-20(19)26-18-6-2-1-3-7-18/h1-13H,14-15H2,(H,23,24) |
| InChIKey | ZPHLHZZOOCLVNB-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.97 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |