C15H13BrClNOS — CID 1265415
2-[(4-bromophenyl)methylsulfanyl]-N-(2-chlorophenyl)acetamide (PubChem CID 1265415) has the molecular formula C15H13BrClNOS and a molecular weight of 370.70 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylsulfanyl]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[(4-bromophenyl)methylsulfanyl]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 1265415 |
| Molecular Formula | C15H13BrClNOS |
| Molecular Weight | 370.70 g/mol |
| Exact Mass | 368.96 |
| IUPAC Name | 2-[(4-bromophenyl)methylsulfanyl]-N-(2-chlorophenyl)acetamide |
| SMILES | O=C(CSCc1ccc(Br)cc1)Nc1ccccc1Cl |
| InChI | InChI=1S/C15H13BrClNOS/c16-12-7-5-11(6-8-12)9-20-10-15(19)18-14-4-2-1-3-13(14)17/h1-8H,9-10H2,(H,18,19) |
| InChIKey | PVOPNVBDAAOMRT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.70 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |