C23H21NO3S — CID 7749615
[2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3,5-dimethylbenzoate (PubChem CID 7749615) has the molecular formula C23H21NO3S and a molecular weight of 391.49 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3,5-dimethylbenzoate.
| Compound Name | [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 7749615 |
| Molecular Formula | C23H21NO3S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)OCC(=O)Nc2ccccc2Sc2ccccc2)c1 |
| InChI | InChI=1S/C23H21NO3S/c1-16-12-17(2)14-18(13-16)23(26)27-15-22(25)24-20-10-6-7-11-21(20)28-19-8-4-3-5-9-19/h3-14H,15H2,1-2H3,(H,24,25) |
| InChIKey | DMRJQJSIJSJISF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |