C20H26N2O6S3 — CID 126602088
2-[[2-[2-(2,4-dimethylphenyl)sulfanylanilino]-2-oxoethyl]-methylsulfonylamino]ethyl methanesulfonate (PubChem CID 126602088) has the molecular formula C20H26N2O6S3 and a molecular weight of 486.64 g/mol. Its IUPAC name is 2-[[2-[2-(2,4-dimethylphenyl)sulfanylanilino]-2-oxoethyl]-methylsulfonylamino]ethyl methanesulfonate.
| Compound Name | 2-[[2-[2-(2,4-dimethylphenyl)sulfanylanilino]-2-oxoethyl]-methylsulfonylamino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 126602088 |
| Molecular Formula | C20H26N2O6S3 |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 2-[[2-[2-(2,4-dimethylphenyl)sulfanylanilino]-2-oxoethyl]-methylsulfonylamino]ethyl methanesulfonate |
| SMILES | Cc1ccc(Sc2ccccc2NC(=O)CN(CCOS(C)(=O)=O)S(C)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C20H26N2O6S3/c1-15-9-10-18(16(2)13-15)29-19-8-6-5-7-17(19)21-20(23)14-22(30(3,24)25)11-12-28-31(4,26)27/h5-10,13H,11-12,14H2,1-4H3,(H,21,23) |
| InChIKey | BKHJLOGRIIBHKN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|