C19H24N2O2S — CID 145260622
2-[2-(2,4-dimethylphenyl)sulfanylanilino]-N-(2-methoxyethyl)acetamide (PubChem CID 145260622) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is 2-[2-(2,4-dimethylphenyl)sulfanylanilino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[2-(2,4-dimethylphenyl)sulfanylanilino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 145260622 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-[2-(2,4-dimethylphenyl)sulfanylanilino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CNc1ccccc1Sc1ccc(C)cc1C |
| InChI | InChI=1S/C19H24N2O2S/c1-14-8-9-17(15(2)12-14)24-18-7-5-4-6-16(18)21-13-19(22)20-10-11-23-3/h4-9,12,21H,10-11,13H2,1-3H3,(H,20,22) |
| InChIKey | JFYNYHSTVJTEPN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|