C12H17FN2O2 — CID 114254580
2-(2-fluoro-3-methylanilino)-N-(2-methoxyethyl)acetamide (PubChem CID 114254580) has the molecular formula C12H17FN2O2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 2-(2-fluoro-3-methylanilino)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(2-fluoro-3-methylanilino)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 114254580 |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 2-(2-fluoro-3-methylanilino)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CNc1cccc(C)c1F |
| InChI | InChI=1S/C12H17FN2O2/c1-9-4-3-5-10(12(9)13)15-8-11(16)14-6-7-17-2/h3-5,15H,6-8H2,1-2H3,(H,14,16) |
| InChIKey | TVBJOPUOBYSHSJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|