C13H21N3O2 — CID 114041350
3-(2-amino-3-methylanilino)-N-(2-methoxyethyl)propanamide (PubChem CID 114041350) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-(2-amino-3-methylanilino)-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-(2-amino-3-methylanilino)-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 114041350 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 3-(2-amino-3-methylanilino)-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCNc1cccc(C)c1N |
| InChI | InChI=1S/C13H21N3O2/c1-10-4-3-5-11(13(10)14)15-7-6-12(17)16-8-9-18-2/h3-5,15H,6-9,14H2,1-2H3,(H,16,17) |
| InChIKey | WNTWLVSVGSUARR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|