C19H14N4S — CID 168606776
2-[2-(2,4-dimethylphenyl)sulfanylanilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168606776) has the molecular formula C19H14N4S and a molecular weight of 330.42 g/mol. Its IUPAC name is 2-[2-(2,4-dimethylphenyl)sulfanylanilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[2-(2,4-dimethylphenyl)sulfanylanilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168606776 |
| Molecular Formula | C19H14N4S |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-[2-(2,4-dimethylphenyl)sulfanylanilino]ethene-1,1,2-tricarbonitrile |
| SMILES | Cc1ccc(Sc2ccccc2NC(C#N)=C(C#N)C#N)c(C)c1 |
| InChI | InChI=1S/C19H14N4S/c1-13-7-8-18(14(2)9-13)24-19-6-4-3-5-16(19)23-17(12-22)15(10-20)11-21/h3-9,23H,1-2H3 |
| InChIKey | YOEAEUSDRZZVSO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|