C17H10N4 — CID 168606413
2-(2-phenylanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168606413) has the molecular formula C17H10N4 and a molecular weight of 270.30 g/mol. Its IUPAC name is 2-(2-phenylanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(2-phenylanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168606413 |
| Molecular Formula | C17H10N4 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-(2-phenylanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C17H10N4/c18-10-14(11-19)17(12-20)21-16-9-5-4-8-15(16)13-6-2-1-3-7-13/h1-9,21H |
| InChIKey | LEUHBQPEBDGAGR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|